C21H16F3N3O2S — CID 90752283
N-[[2-[3-(trifluoromethoxy)phenyl]-1,3-benzothiazol-4-yl]methoxymethyl]pyridin-2-amine (PubChem CID 90752283) has the molecular formula C21H16F3N3O2S and a molecular weight of 431.44 g/mol. Its IUPAC name is N-[[2-[3-(trifluoromethoxy)phenyl]-1,3-benzothiazol-4-yl]methoxymethyl]pyridin-2-amine.
| Compound Name | N-[[2-[3-(trifluoromethoxy)phenyl]-1,3-benzothiazol-4-yl]methoxymethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 90752283 |
| Molecular Formula | C21H16F3N3O2S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | N-[[2-[3-(trifluoromethoxy)phenyl]-1,3-benzothiazol-4-yl]methoxymethyl]pyridin-2-amine |
| SMILES | FC(F)(F)Oc1cccc(-c2nc3c(COCNc4ccccn4)cccc3s2)c1 |
| InChI | InChI=1S/C21H16F3N3O2S/c22-21(23,24)29-16-7-3-5-14(11-16)20-27-19-15(6-4-8-17(19)30-20)12-28-13-26-18-9-1-2-10-25-18/h1-11H,12-13H2,(H,25,26) |
| InChIKey | HEPMKSNLBRSWST-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|