C8H11NO5 — CID 90755823
4-(2,5-dihydroxypyrrol-1-yl)-2-hydroxybutanoic acid (PubChem CID 90755823) has the molecular formula C8H11NO5 and a molecular weight of 201.18 g/mol. Its IUPAC name is 4-(2,5-dihydroxypyrrol-1-yl)-2-hydroxybutanoic acid.
| Compound Name | 4-(2,5-dihydroxypyrrol-1-yl)-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 90755823 |
| Molecular Formula | C8H11NO5 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 4-(2,5-dihydroxypyrrol-1-yl)-2-hydroxybutanoic acid |
| SMILES | O=C(O)C(O)CCn1c(O)ccc1O |
| InChI | InChI=1S/C8H11NO5/c10-5(8(13)14)3-4-9-6(11)1-2-7(9)12/h1-2,5,10-12H,3-4H2,(H,13,14) |
| InChIKey | IDFURPOALKRNCK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |