C19H17Cl2FN2O7S2 — CID 90757649
ethyl 2-[3-[chloro(phenyl)sulfamoyl]-5-fluoro-2-methylindol-1-yl]-2-chlorosulfonyloxyacetate (PubChem CID 90757649) has the molecular formula C19H17Cl2FN2O7S2 and a molecular weight of 539.39 g/mol. Its IUPAC name is ethyl 2-[3-[chloro(phenyl)sulfamoyl]-5-fluoro-2-methylindol-1-yl]-2-chlorosulfonyloxyacetate.
| Compound Name | ethyl 2-[3-[chloro(phenyl)sulfamoyl]-5-fluoro-2-methylindol-1-yl]-2-chlorosulfonyloxyacetate |
|---|---|
| PubChem CID | 90757649 |
| Molecular Formula | C19H17Cl2FN2O7S2 |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 537.98 |
| IUPAC Name | ethyl 2-[3-[chloro(phenyl)sulfamoyl]-5-fluoro-2-methylindol-1-yl]-2-chlorosulfonyloxyacetate |
| SMILES | CCOC(=O)C(OS(=O)(=O)Cl)n1c(C)c(S(=O)(=O)N(Cl)c2ccccc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C19H17Cl2FN2O7S2/c1-3-30-19(25)18(31-33(21,28)29)23-12(2)17(15-11-13(22)9-10-16(15)23)32(26,27)24(20)14-7-5-4-6-8-14/h4-11,18H,3H2,1-2H3 |
| InChIKey | QWALWHAPBTYVLX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|