C29H43N3O4 — CID 90758373
3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[3-[[3-(1-methoxypropoxy)phenyl]methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione (PubChem CID 90758373) has the molecular formula C29H43N3O4 and a molecular weight of 497.68 g/mol. Its IUPAC name is 3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[3-[[3-(1-methoxypropoxy)phenyl]methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[3-[[3-(1-methoxypropoxy)phenyl]methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 90758373 |
| Molecular Formula | C29H43N3O4 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.33 |
| IUPAC Name | 3-[(1-amino-3-cyclohexylpropan-2-yl)amino]-4-[3-[[3-(1-methoxypropoxy)phenyl]methyl]piperidin-1-yl]cyclobut-3-ene-1,2-dione |
| SMILES | CCC(OC)Oc1cccc(CC2CCCN(c3c(NC(CN)CC4CCCCC4)c(=O)c3=O)C2)c1 |
| InChI | InChI=1S/C29H43N3O4/c1-3-25(35-2)36-24-13-7-11-21(17-24)15-22-12-8-14-32(19-22)27-26(28(33)29(27)34)31-23(18-30)16-20-9-5-4-6-10-20/h7,11,13,17,20,22-23,25,31H,3-6,8-10,12,14-16,18-19,30H2,1-2H3 |
| InChIKey | WBXPMNAJPZXWDT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|