C16H28N2O3S — CID 90758630
9-amino-1-phenylmethoxynonane-1-sulfonamide (PubChem CID 90758630) has the molecular formula C16H28N2O3S and a molecular weight of 328.48 g/mol. Its IUPAC name is 9-amino-1-phenylmethoxynonane-1-sulfonamide.
| Compound Name | 9-amino-1-phenylmethoxynonane-1-sulfonamide |
|---|---|
| PubChem CID | 90758630 |
| Molecular Formula | C16H28N2O3S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 9-amino-1-phenylmethoxynonane-1-sulfonamide |
| SMILES | NCCCCCCCCC(OCc1ccccc1)S(N)(=O)=O |
| InChI | InChI=1S/C16H28N2O3S/c17-13-9-4-2-1-3-8-12-16(22(18,19)20)21-14-15-10-6-5-7-11-15/h5-7,10-11,16H,1-4,8-9,12-14,17H2,(H2,18,19,20) |
| InChIKey | MBLSYXKRUXWQOY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|