C17H20Cl2N2O3 — CID 90760905
(2S)-3-(4-aminophenyl)-2-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]amino]propanoic acid (PubChem CID 90760905) has the molecular formula C17H20Cl2N2O3 and a molecular weight of 371.26 g/mol. Its IUPAC name is (2S)-3-(4-aminophenyl)-2-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]amino]propanoic acid.
| Compound Name | (2S)-3-(4-aminophenyl)-2-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 90760905 |
| Molecular Formula | C17H20Cl2N2O3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (2S)-3-(4-aminophenyl)-2-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]amino]propanoic acid |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)N[C@@H](Cc1ccc(N)cc1)C(=O)O |
| InChI | InChI=1S/C17H20Cl2N2O3/c1-17(2)11(8-13(18)19)14(17)15(22)21-12(16(23)24)7-9-3-5-10(20)6-4-9/h3-6,8,11-12,14H,7,20H2,1-2H3,(H,21,22)(H,23,24)/t11?,12-,14?/m0/s1 |
| InChIKey | YQNMSHBUWKVKST-LXVYMNJGSA-N |
| XLogP | 2.97 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|