C19H26N2O5 — CID 54232427
methyl 3-[[(2S)-3-(4-aminophenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2,2-dimethylcyclobutane-1-carboxylate (PubChem CID 54232427) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl 3-[[(2S)-3-(4-aminophenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2,2-dimethylcyclobutane-1-carboxylate.
| Compound Name | methyl 3-[[(2S)-3-(4-aminophenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2,2-dimethylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 54232427 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | methyl 3-[[(2S)-3-(4-aminophenyl)-1-methoxy-1-oxopropan-2-yl]carbamoyl]-2,2-dimethylcyclobutane-1-carboxylate |
| SMILES | COC(=O)C1CC(C(=O)N[C@@H](Cc2ccc(N)cc2)C(=O)OC)C1(C)C |
| InChI | InChI=1S/C19H26N2O5/c1-19(2)13(10-14(19)17(23)25-3)16(22)21-15(18(24)26-4)9-11-5-7-12(20)8-6-11/h5-8,13-15H,9-10,20H2,1-4H3,(H,21,22)/t13?,14?,15-/m0/s1 |
| InChIKey | QKFANNXRFUZVDY-NRXISQOPSA-N |
| XLogP | 1.30 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|