C21H23N3 — CID 90766818
N,N-dimethyl-4-(2-phenyl-2-phenyldiazenylethyl)cyclopenta-1,4-dien-1-amine (PubChem CID 90766818) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-phenyl-2-phenyldiazenylethyl)cyclopenta-1,4-dien-1-amine.
| Compound Name | N,N-dimethyl-4-(2-phenyl-2-phenyldiazenylethyl)cyclopenta-1,4-dien-1-amine |
|---|---|
| PubChem CID | 90766818 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N,N-dimethyl-4-(2-phenyl-2-phenyldiazenylethyl)cyclopenta-1,4-dien-1-amine |
| SMILES | CN(C)C1=CCC(CC(/N=N/c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C21H23N3/c1-24(2)20-14-13-17(15-20)16-21(18-9-5-3-6-10-18)23-22-19-11-7-4-8-12-19/h3-12,14-15,21H,13,16H2,1-2H3/b23-22+ |
| InChIKey | KOIUJSAJBPLWNQ-GHVJWSGMSA-N |
| XLogP | 5.68 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|