C23H26N2 — CID 91368914
[2-(3-tert-butylcyclopenta-1,3-dien-1-yl)-1-phenylethyl]-phenyldiazene (PubChem CID 91368914) has the molecular formula C23H26N2 and a molecular weight of 330.48 g/mol. Its IUPAC name is [2-(3-tert-butylcyclopenta-1,3-dien-1-yl)-1-phenylethyl]-phenyldiazene.
| Compound Name | [2-(3-tert-butylcyclopenta-1,3-dien-1-yl)-1-phenylethyl]-phenyldiazene |
|---|---|
| PubChem CID | 91368914 |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | [2-(3-tert-butylcyclopenta-1,3-dien-1-yl)-1-phenylethyl]-phenyldiazene |
| SMILES | CC(C)(C)C1=CCC(CC(/N=N/c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C23H26N2/c1-23(2,3)20-15-14-18(16-20)17-22(19-10-6-4-7-11-19)25-24-21-12-8-5-9-13-21/h4-13,15-16,22H,14,17H2,1-3H3/b25-24+ |
| InChIKey | DLUNOLNSMHSPSG-OCOZRVBESA-N |
| XLogP | 7.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|