C26H27F3N4O2 — CID 90767075
2-[[4-[1-(4-methoxynaphthalene-1-carbonyl)piperidin-4-yl]-3-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 90767075) has the molecular formula C26H27F3N4O2 and a molecular weight of 484.52 g/mol. Its IUPAC name is 2-[[4-[1-(4-methoxynaphthalene-1-carbonyl)piperidin-4-yl]-3-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 2-[[4-[1-(4-methoxynaphthalene-1-carbonyl)piperidin-4-yl]-3-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 90767075 |
| Molecular Formula | C26H27F3N4O2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2-[[4-[1-(4-methoxynaphthalene-1-carbonyl)piperidin-4-yl]-3-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | COc1ccc(C(=O)N2CCC(c3ccc(CN=C(N)N)cc3C(F)(F)F)CC2)c2ccccc12 |
| InChI | InChI=1S/C26H27F3N4O2/c1-35-23-9-8-21(19-4-2-3-5-20(19)23)24(34)33-12-10-17(11-13-33)18-7-6-16(15-32-25(30)31)14-22(18)26(27,28)29/h2-9,14,17H,10-13,15H2,1H3,(H4,30,31,32) |
| InChIKey | KRRKDCZVTDYTQB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|