C11H20N2 — CID 90767630
3-ethyl-4-methylocta-4,6-dienimidamide (PubChem CID 90767630) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is 3-ethyl-4-methylocta-4,6-dienimidamide.
| Compound Name | 3-ethyl-4-methylocta-4,6-dienimidamide |
|---|---|
| PubChem CID | 90767630 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 3-ethyl-4-methylocta-4,6-dienimidamide |
| SMILES | [H]/N=C(\N)CC(CC)C(C)=CC=CC |
| InChI | InChI=1S/C11H20N2/c1-4-6-7-9(3)10(5-2)8-11(12)13/h4,6-7,10H,5,8H2,1-3H3,(H3,12,13) |
| InChIKey | FPWUKPMQCWYXRE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|