C14H22O6 — CID 90773272
2-(3,7-dimethylocta-2,6-dienoxy)-3-hydroxybutanedioic acid (PubChem CID 90773272) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienoxy)-3-hydroxybutanedioic acid.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienoxy)-3-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 90773272 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienoxy)-3-hydroxybutanedioic acid |
| SMILES | CC(C)=CCCC(C)=CCOC(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C14H22O6/c1-9(2)5-4-6-10(3)7-8-20-12(14(18)19)11(15)13(16)17/h5,7,11-12,15H,4,6,8H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | KIMGMCPBCQRSON-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|