C11H12N2O — CID 90776813
3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-iminopropanamide (PubChem CID 90776813) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-iminopropanamide.
| Compound Name | 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-iminopropanamide |
|---|---|
| PubChem CID | 90776813 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3-(3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-3-iminopropanamide |
| SMILES | [H]/N=C(\CC(N)=O)c1ccc2c(c1)CC2 |
| InChI | InChI=1S/C11H12N2O/c12-10(6-11(13)14)9-4-2-7-1-3-8(7)5-9/h2,4-5,12H,1,3,6H2,(H2,13,14)/b12-10+ |
| InChIKey | IHPTUTWXQCQJFS-ZRDIBKRKSA-N |
| XLogP | 1.03 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|