C18H22N2O — CID 90781913
N-[6-[2-(C,N-dimethylcarbonimidoyl)phenyl]-5-methylidenehepta-1,3-dien-2-yl]formamide (PubChem CID 90781913) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-[6-[2-(C,N-dimethylcarbonimidoyl)phenyl]-5-methylidenehepta-1,3-dien-2-yl]formamide.
| Compound Name | N-[6-[2-(C,N-dimethylcarbonimidoyl)phenyl]-5-methylidenehepta-1,3-dien-2-yl]formamide |
|---|---|
| PubChem CID | 90781913 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-[6-[2-(C,N-dimethylcarbonimidoyl)phenyl]-5-methylidenehepta-1,3-dien-2-yl]formamide |
| SMILES | C=C(C=CC(=C)C(C)c1ccccc1/C(C)=N/C)NC=O |
| InChI | InChI=1S/C18H22N2O/c1-13(10-11-14(2)20-12-21)15(3)17-8-6-7-9-18(17)16(4)19-5/h6-12,15H,1-2H2,3-5H3,(H,20,21)/b11-10?,19-16+ |
| InChIKey | XPJUPVPYXPKIAC-CYCFRLSGSA-N |
| XLogP | 3.60 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|