C17H29BO2SSi — CID 90782135
CID 90782135 (PubChem CID 90782135) has the molecular formula C17H29BO2SSi and a molecular weight of 336.38 g/mol.
| Compound Name | CID 90782135 |
|---|---|
| PubChem CID | 90782135 |
| Molecular Formula | C17H29BO2SSi |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | — |
| SMILES | [B]Cc1c(C)sc(C)c1[C@H]1COC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H29BO2SSi/c1-11-13(8-18)16(12(2)21-11)14-9-19-10-15(14)20-22(6,7)17(3,4)5/h14-15H,8-10H2,1-7H3/t14-,15-/m0/s1 |
| InChIKey | XCKDFEPCIIPZKD-GJZGRUSLSA-N |
| XLogP | 4.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|