C17H37NO3Si2 — CID 102470285
tert-butyl-[[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-4-yl]oxy]-dimethylsilane (PubChem CID 102470285) has the molecular formula C17H37NO3Si2 and a molecular weight of 359.66 g/mol. Its IUPAC name is tert-butyl-[[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-4-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-4-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 102470285 |
| Molecular Formula | C17H37NO3Si2 |
| Molecular Weight | 359.66 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | tert-butyl-[[(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-4-yl]oxy]-dimethylsilane |
| SMILES | CC1=[N+]([O-])C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H37NO3Si2/c1-13-15(21-23(10,11)17(5,6)7)14(12-18(13)19)20-22(8,9)16(2,3)4/h14-15H,12H2,1-11H3/t14-,15-/m0/s1 |
| InChIKey | PNCVPONVIHWGHU-GJZGRUSLSA-N |
| XLogP | 4.75 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.66 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|