C15H31NO4Si — CID 56641398
tert-butyl-[[(3R)-5-(3,3-dimethoxypropyl)-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-3-yl]oxy]-dimethylsilane (PubChem CID 56641398) has the molecular formula C15H31NO4Si and a molecular weight of 317.50 g/mol. Its IUPAC name is tert-butyl-[[(3R)-5-(3,3-dimethoxypropyl)-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-3-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(3R)-5-(3,3-dimethoxypropyl)-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 56641398 |
| Molecular Formula | C15H31NO4Si |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | tert-butyl-[[(3R)-5-(3,3-dimethoxypropyl)-1-oxido-3,4-dihydro-2H-pyrrol-1-ium-3-yl]oxy]-dimethylsilane |
| SMILES | COC(CCC1=[N+]([O-])C[C@H](O[Si](C)(C)C(C)(C)C)C1)OC |
| InChI | InChI=1S/C15H31NO4Si/c1-15(2,3)21(6,7)20-13-10-12(16(17)11-13)8-9-14(18-4)19-5/h13-14H,8-11H2,1-7H3/t13-/m1/s1 |
| InChIKey | FDKWJAANNFOOPE-CYBMUJFWSA-N |
| XLogP | 3.13 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|