C18H40O7 — CID 90787039
1,3-bis(2-methoxyethoxy)propane;1,5-dimethoxy-3-(methoxymethyl)pentane (PubChem CID 90787039) has the molecular formula C18H40O7 and a molecular weight of 368.51 g/mol. Its IUPAC name is 1,3-bis(2-methoxyethoxy)propane;1,5-dimethoxy-3-(methoxymethyl)pentane.
| Compound Name | 1,3-bis(2-methoxyethoxy)propane;1,5-dimethoxy-3-(methoxymethyl)pentane |
|---|---|
| PubChem CID | 90787039 |
| Molecular Formula | C18H40O7 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | 1,3-bis(2-methoxyethoxy)propane;1,5-dimethoxy-3-(methoxymethyl)pentane |
| SMILES | COCCC(CCOC)COC.COCCOCCCOCCOC |
| InChI | InChI=1S/C9H20O4.C9H20O3/c1-10-6-8-12-4-3-5-13-9-7-11-2;1-10-6-4-9(8-12-3)5-7-11-2/h3-9H2,1-2H3;9H,4-8H2,1-3H3 |
| InChIKey | LFQNTLNRNDGBBX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|