C17H30O6Si — CID 90787308
methyl (1R,3S,4R,5S,6R,7R)-9,9-ditert-butyl-6-hydroxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate (PubChem CID 90787308) has the molecular formula C17H30O6Si and a molecular weight of 358.51 g/mol. Its IUPAC name is methyl (1R,3S,4R,5S,6R,7R)-9,9-ditert-butyl-6-hydroxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate.
| Compound Name | methyl (1R,3S,4R,5S,6R,7R)-9,9-ditert-butyl-6-hydroxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate |
|---|---|
| PubChem CID | 90787308 |
| Molecular Formula | C17H30O6Si |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | methyl (1R,3S,4R,5S,6R,7R)-9,9-ditert-butyl-6-hydroxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2O[C@@H]3CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]3[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C17H30O6Si/c1-16(2,3)24(17(4,5)6)21-8-9-13(23-24)12(18)10-11(14(10)22-9)15(19)20-7/h9-14,18H,8H2,1-7H3/t9-,10+,11-,12-,13+,14+/m1/s1 |
| InChIKey | XNKXAFIZJHBNSF-FDFVQJQPSA-N |
| XLogP | 1.99 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|