C20H24N4O2 — CID 90790428
2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-pyridin-4-yl-4,4a,6,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 90790428) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-pyridin-4-yl-4,4a,6,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-pyridin-4-yl-4,4a,6,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 90790428 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-pyridin-4-yl-4,4a,6,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CC1(C)CC(=O)C2C(=NC(COCCN)=C(C#N)C2c2ccncc2)C1 |
| InChI | InChI=1S/C20H24N4O2/c1-20(2)9-15-19(17(25)10-20)18(13-3-6-23-7-4-13)14(11-22)16(24-15)12-26-8-5-21/h3-4,6-7,18-19H,5,8-10,12,21H2,1-2H3 |
| InChIKey | WQELQZKUIZKRQO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|