C18H22N6O2 — CID 90851683
2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-(1,3,5-triazin-2-yl)-4,4a,6,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 90851683) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-(1,3,5-triazin-2-yl)-4,4a,6,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-(1,3,5-triazin-2-yl)-4,4a,6,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 90851683 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-(2-aminoethoxymethyl)-7,7-dimethyl-5-oxo-4-(1,3,5-triazin-2-yl)-4,4a,6,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CC1(C)CC(=O)C2C(=NC(COCCN)=C(C#N)C2c2ncncn2)C1 |
| InChI | InChI=1S/C18H22N6O2/c1-18(2)5-12-16(14(25)6-18)15(17-22-9-21-10-23-17)11(7-20)13(24-12)8-26-4-3-19/h9-10,15-16H,3-6,8,19H2,1-2H3 |
| InChIKey | AJHGBPFUHAYCKK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|