C11H16N2O4 — CID 90790991
(2,5-dihydroxypyrrol-1-yl) 4-imino-5-methylhexanoate (PubChem CID 90790991) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-imino-5-methylhexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-imino-5-methylhexanoate |
|---|---|
| PubChem CID | 90790991 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-imino-5-methylhexanoate |
| SMILES | [H]/N=C(/CCC(=O)On1c(O)ccc1O)C(C)C |
| InChI | InChI=1S/C11H16N2O4/c1-7(2)8(12)3-6-11(16)17-13-9(14)4-5-10(13)15/h4-5,7,12,14-15H,3,6H2,1-2H3/b12-8- |
| InChIKey | GABMZZQHQWRPHV-WQLSENKSSA-N |
| XLogP | 1.31 |
| TPSA | 95.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|