C18H21N3O2S — CID 90792385
N'-acetyl-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-benzothiophene-2-carbohydrazide (PubChem CID 90792385) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is N'-acetyl-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-benzothiophene-2-carbohydrazide.
| Compound Name | N'-acetyl-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 90792385 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N'-acetyl-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-1-benzothiophene-2-carbohydrazide |
| SMILES | CC(=O)NN(C(=O)c1cc2ccccc2s1)[C@H]1CN2CCC1CC2 |
| InChI | InChI=1S/C18H21N3O2S/c1-12(22)19-21(15-11-20-8-6-13(15)7-9-20)18(23)17-10-14-4-2-3-5-16(14)24-17/h2-5,10,13,15H,6-9,11H2,1H3,(H,19,22)/t15-/m0/s1 |
| InChIKey | UGWGJXUOBBKXPK-HNNXBMFYSA-N |
| XLogP | 2.49 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|