C24H19N3O4S3 — CID 97292840
(2R)-3-acetyl-N',N'-bis(1-benzothiophene-2-carbonyl)-1,3-thiazolidine-2-carbohydrazide (PubChem CID 97292840) has the molecular formula C24H19N3O4S3 and a molecular weight of 509.63 g/mol. Its IUPAC name is (2R)-3-acetyl-N',N'-bis(1-benzothiophene-2-carbonyl)-1,3-thiazolidine-2-carbohydrazide.
| Compound Name | (2R)-3-acetyl-N',N'-bis(1-benzothiophene-2-carbonyl)-1,3-thiazolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 97292840 |
| Molecular Formula | C24H19N3O4S3 |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.05 |
| IUPAC Name | (2R)-3-acetyl-N',N'-bis(1-benzothiophene-2-carbonyl)-1,3-thiazolidine-2-carbohydrazide |
| SMILES | CC(=O)N1CCS[C@@H]1C(=O)NN(C(=O)c1cc2ccccc2s1)C(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C24H19N3O4S3/c1-14(28)26-10-11-32-24(26)21(29)25-27(22(30)19-12-15-6-2-4-8-17(15)33-19)23(31)20-13-16-7-3-5-9-18(16)34-20/h2-9,12-13,24H,10-11H2,1H3,(H,25,29)/t24-/m1/s1 |
| InChIKey | SUBVCYYTAVJPFA-XMMPIXPASA-N |
| XLogP | 4.35 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|