C15H20N2O6S — CID 90792459
benzyl N-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)carbamate (PubChem CID 90792459) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is benzyl N-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)carbamate.
| Compound Name | benzyl N-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)carbamate |
|---|---|
| PubChem CID | 90792459 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | benzyl N-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)carbamate |
| SMILES | O=C(NS(=O)(=O)N1CCC2(CC1)OCCO2)OCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O6S/c18-14(21-12-13-4-2-1-3-5-13)16-24(19,20)17-8-6-15(7-9-17)22-10-11-23-15/h1-5H,6-12H2,(H,16,18) |
| InChIKey | FQBOSBFGTHCQOT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |