C20H27F3O7S — CID 144944598
benzyl 8-(trifluoromethylsulfonyloxymethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate;ethane (PubChem CID 144944598) has the molecular formula C20H27F3O7S and a molecular weight of 468.49 g/mol. Its IUPAC name is benzyl 8-(trifluoromethylsulfonyloxymethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate;ethane.
| Compound Name | benzyl 8-(trifluoromethylsulfonyloxymethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate;ethane |
|---|---|
| PubChem CID | 144944598 |
| Molecular Formula | C20H27F3O7S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | benzyl 8-(trifluoromethylsulfonyloxymethyl)-1,4-dioxaspiro[4.5]decane-8-carboxylate;ethane |
| SMILES | CC.O=C(OCc1ccccc1)C1(COS(=O)(=O)C(F)(F)F)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C18H21F3O7S.C2H6/c19-18(20,21)29(23,24)28-13-16(6-8-17(9-7-16)26-10-11-27-17)15(22)25-12-14-4-2-1-3-5-14;1-2/h1-5H,6-13H2;1-2H3 |
| InChIKey | XYHDSVJTMNUZIF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|