C18H21F3O7S — CID 157443185
(8-benzyl-1,4-dioxaspiro[4.5]decan-8-yl)methyl trifluoromethanesulfonate;carbon dioxide (PubChem CID 157443185) has the molecular formula C18H21F3O7S and a molecular weight of 438.42 g/mol. Its IUPAC name is (8-benzyl-1,4-dioxaspiro[4.5]decan-8-yl)methyl trifluoromethanesulfonate;carbon dioxide.
| Compound Name | (8-benzyl-1,4-dioxaspiro[4.5]decan-8-yl)methyl trifluoromethanesulfonate;carbon dioxide |
|---|---|
| PubChem CID | 157443185 |
| Molecular Formula | C18H21F3O7S |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (8-benzyl-1,4-dioxaspiro[4.5]decan-8-yl)methyl trifluoromethanesulfonate;carbon dioxide |
| SMILES | O=C=O.O=S(=O)(OCC1(Cc2ccccc2)CCC2(CC1)OCCO2)C(F)(F)F |
| InChI | InChI=1S/C17H21F3O5S.CO2/c18-17(19,20)26(21,22)25-13-15(12-14-4-2-1-3-5-14)6-8-16(9-7-15)23-10-11-24-16;2-1-3/h1-5H,6-13H2; |
| InChIKey | BRXLSWYSWWGVBU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|