C11H14O5S — CID 91282898
2-benzyl-1,4-dioxane-2-sulfonic acid (PubChem CID 91282898) has the molecular formula C11H14O5S and a molecular weight of 258.29 g/mol. Its IUPAC name is 2-benzyl-1,4-dioxane-2-sulfonic acid.
| Compound Name | 2-benzyl-1,4-dioxane-2-sulfonic acid |
|---|---|
| PubChem CID | 91282898 |
| Molecular Formula | C11H14O5S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-benzyl-1,4-dioxane-2-sulfonic acid |
| SMILES | O=S(=O)(O)C1(Cc2ccccc2)COCCO1 |
| InChI | InChI=1S/C11H14O5S/c12-17(13,14)11(9-15-6-7-16-11)8-10-4-2-1-3-5-10/h1-5H,6-9H2,(H,12,13,14) |
| InChIKey | BERWIINAWMPFNK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|