C15H16O3 — CID 71426985
8-benzyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol (PubChem CID 71426985) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 8-benzyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol.
| Compound Name | 8-benzyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol |
|---|---|
| PubChem CID | 71426985 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 8-benzyl-1,4-dioxaspiro[4.5]deca-6,9-dien-8-ol |
| SMILES | OC1(Cc2ccccc2)C=CC2(C=C1)OCCO2 |
| InChI | InChI=1S/C15H16O3/c16-14(12-13-4-2-1-3-5-13)6-8-15(9-7-14)17-10-11-18-15/h1-9,16H,10-12H2 |
| InChIKey | ZWHGFRLNQLAJMC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|