C10H13N3OS2 — CID 90793423
ethane;4-(2-methylsulfinylpyrimidin-4-yl)-1,3-thiazole (PubChem CID 90793423) has the molecular formula C10H13N3OS2 and a molecular weight of 255.37 g/mol. Its IUPAC name is ethane;4-(2-methylsulfinylpyrimidin-4-yl)-1,3-thiazole.
| Compound Name | ethane;4-(2-methylsulfinylpyrimidin-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 90793423 |
| Molecular Formula | C10H13N3OS2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | ethane;4-(2-methylsulfinylpyrimidin-4-yl)-1,3-thiazole |
| SMILES | CC.CS(=O)c1nccc(-c2cscn2)n1 |
| InChI | InChI=1S/C8H7N3OS2.C2H6/c1-14(12)8-9-3-2-6(11-8)7-4-13-5-10-7;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | DUCKWXPHKYDRNY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |