C9H9N3S — CID 160538111
4-(2-ethylpyrimidin-4-yl)-1,3-thiazole (PubChem CID 160538111) has the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. Its IUPAC name is 4-(2-ethylpyrimidin-4-yl)-1,3-thiazole.
| Compound Name | 4-(2-ethylpyrimidin-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 160538111 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 4-(2-ethylpyrimidin-4-yl)-1,3-thiazole |
| SMILES | CCc1nccc(-c2cscn2)n1 |
| InChI | InChI=1S/C9H9N3S/c1-2-9-10-4-3-7(12-9)8-5-13-6-11-8/h3-6H,2H2,1H3 |
| InChIKey | IASMNKGEEILZEC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |