C21H33N3S — CID 160538110
benzene;ethane;4-(2-ethylpyrimidin-4-yl)-1,3-thiazole (PubChem CID 160538110) has the molecular formula C21H33N3S and a molecular weight of 359.58 g/mol. Its IUPAC name is benzene;ethane;4-(2-ethylpyrimidin-4-yl)-1,3-thiazole.
| Compound Name | benzene;ethane;4-(2-ethylpyrimidin-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 160538110 |
| Molecular Formula | C21H33N3S |
| Molecular Weight | 359.58 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | benzene;ethane;4-(2-ethylpyrimidin-4-yl)-1,3-thiazole |
| SMILES | CC.CC.CC.CCc1nccc(-c2cscn2)n1.c1ccccc1 |
| InChI | InChI=1S/C9H9N3S.C6H6.3C2H6/c1-2-9-10-4-3-7(12-9)8-5-13-6-11-8;1-2-4-6-5-3-1;3*1-2/h3-6H,2H2,1H3;1-6H;3*1-2H3 |
| InChIKey | QWKQKNUCVJVHDL-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.58 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |