C13H18N2S2 — CID 70025140
2-heptyl-4-(1,3-thiazol-4-yl)-1,3-thiazole (PubChem CID 70025140) has the molecular formula C13H18N2S2 and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-heptyl-4-(1,3-thiazol-4-yl)-1,3-thiazole.
| Compound Name | 2-heptyl-4-(1,3-thiazol-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 70025140 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-heptyl-4-(1,3-thiazol-4-yl)-1,3-thiazole |
| SMILES | CCCCCCCc1nc(-c2cscn2)cs1 |
| InChI | InChI=1S/C13H18N2S2/c1-2-3-4-5-6-7-13-15-12(9-17-13)11-8-16-10-14-11/h8-10H,2-7H2,1H3 |
| InChIKey | RWYQBWCGGYHGRC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|