C12H16N2S2 — CID 54071761
2-hexyl-4-(1,3-thiazol-4-yl)-1,3-thiazole (PubChem CID 54071761) has the molecular formula C12H16N2S2 and a molecular weight of 252.41 g/mol. Its IUPAC name is 2-hexyl-4-(1,3-thiazol-4-yl)-1,3-thiazole.
| Compound Name | 2-hexyl-4-(1,3-thiazol-4-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 54071761 |
| Molecular Formula | C12H16N2S2 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 2-hexyl-4-(1,3-thiazol-4-yl)-1,3-thiazole |
| SMILES | CCCCCCc1nc(-c2cscn2)cs1 |
| InChI | InChI=1S/C12H16N2S2/c1-2-3-4-5-6-12-14-11(8-16-12)10-7-15-9-13-10/h7-9H,2-6H2,1H3 |
| InChIKey | HJIRLNIDVRCAMU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|