C24H29F2N3O3 — CID 90797728
3-[3-amino-6'-(3,5-difluorophenyl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-2'-yl]-5-methylhexan-1-ol (PubChem CID 90797728) has the molecular formula C24H29F2N3O3 and a molecular weight of 445.51 g/mol. Its IUPAC name is 3-[3-amino-6'-(3,5-difluorophenyl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-2'-yl]-5-methylhexan-1-ol.
| Compound Name | 3-[3-amino-6'-(3,5-difluorophenyl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-2'-yl]-5-methylhexan-1-ol |
|---|---|
| PubChem CID | 90797728 |
| Molecular Formula | C24H29F2N3O3 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 3-[3-amino-6'-(3,5-difluorophenyl)-2-methylspiro[1,2,4-oxadiazole-5,4'-2,3-dihydrochromene]-2'-yl]-5-methylhexan-1-ol |
| SMILES | CC(C)CC(CCO)C1CC2(N=C(N)N(C)O2)c2cc(-c3cc(F)cc(F)c3)ccc2O1 |
| InChI | InChI=1S/C24H29F2N3O3/c1-14(2)8-16(6-7-30)22-13-24(28-23(27)29(3)32-24)20-11-15(4-5-21(20)31-22)17-9-18(25)12-19(26)10-17/h4-5,9-12,14,16,22,30H,6-8,13H2,1-3H3,(H2,27,28) |
| InChIKey | ZRWSNWUTGGBRPY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |