C21H19NO4S — CID 90804219
2-[4-[2-[ethylsulfanyl-(2-hydroxyphenyl)methyl]-1,3-oxazol-5-yl]phenyl]prop-2-enoic acid (PubChem CID 90804219) has the molecular formula C21H19NO4S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-[4-[2-[ethylsulfanyl-(2-hydroxyphenyl)methyl]-1,3-oxazol-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | 2-[4-[2-[ethylsulfanyl-(2-hydroxyphenyl)methyl]-1,3-oxazol-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90804219 |
| Molecular Formula | C21H19NO4S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 2-[4-[2-[ethylsulfanyl-(2-hydroxyphenyl)methyl]-1,3-oxazol-5-yl]phenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1ccc(-c2cnc(C(SCC)c3ccccc3O)o2)cc1 |
| InChI | InChI=1S/C21H19NO4S/c1-3-27-19(16-6-4-5-7-17(16)23)20-22-12-18(26-20)15-10-8-14(9-11-15)13(2)21(24)25/h4-12,19,23H,2-3H2,1H3,(H,24,25) |
| InChIKey | YIVRBVQQIKGDRA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|