C33H60O3Si2 — CID 90806507
(3R,9S,10R,13R,14R,17S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-17-ethyl-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 90806507) has the molecular formula C33H60O3Si2 and a molecular weight of 561.01 g/mol. Its IUPAC name is (3R,9S,10R,13R,14R,17S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-17-ethyl-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,9S,10R,13R,14R,17S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-17-ethyl-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 90806507 |
| Molecular Formula | C33H60O3Si2 |
| Molecular Weight | 561.01 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | (3R,9S,10R,13R,14R,17S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-17-ethyl-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@H]1CC[C@H]2C3=CC=C4C[C@@](O)(O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H60O3Si2/c1-14-23-16-18-26-25-17-15-24-21-33(34,36-38(12,13)30(5,6)7)22-28(35-37(10,11)29(2,3)4)32(24,9)27(25)19-20-31(23,26)8/h15,17,23,26-28,34H,14,16,18-22H2,1-13H3/t23-,26-,27-,28?,31+,32-,33+/m0/s1 |
| InChIKey | WFKBSCAYDMTOKJ-IDESMYLCSA-N |
| XLogP | 9.61 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.01 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|