C35H62O5Si2 — CID 91572958
2-[[(1S,3R,9S,10R,13R,17S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-17-ethyl-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]acetic acid (PubChem CID 91572958) has the molecular formula C35H62O5Si2 and a molecular weight of 619.05 g/mol. Its IUPAC name is 2-[[(1S,3R,9S,10R,13R,17S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-17-ethyl-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]acetic acid.
| Compound Name | 2-[[(1S,3R,9S,10R,13R,17S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-17-ethyl-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 91572958 |
| Molecular Formula | C35H62O5Si2 |
| Molecular Weight | 619.05 g/mol |
| Exact Mass | 618.41 |
| IUPAC Name | 2-[[(1S,3R,9S,10R,13R,17S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-17-ethyl-10,13-dimethyl-1,2,4,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxy]acetic acid |
| SMILES | CC[C@H]1CCC2C3=CC=C4C[C@@](OCC(=O)O)(O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C35H62O5Si2/c1-14-24-16-18-27-26-17-15-25-21-35(38-23-30(36)37,40-42(12,13)32(5,6)7)22-29(39-41(10,11)31(2,3)4)34(25,9)28(26)19-20-33(24,27)8/h15,17,24,27-29H,14,16,18-23H2,1-13H3,(H,36,37)/t24-,27?,28-,29-,33+,34-,35+/m0/s1 |
| InChIKey | AIDCRRCVAQVJMJ-IXOPVDADSA-N |
| XLogP | 9.72 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.05 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|