C24H27NO5 — CID 90807412
2-[1-[1-amino-2-oxo-2-(2-oxo-1,2-diphenylethoxy)ethyl]cyclohexyl]acetic acid (PubChem CID 90807412) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 2-[1-[1-amino-2-oxo-2-(2-oxo-1,2-diphenylethoxy)ethyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[1-amino-2-oxo-2-(2-oxo-1,2-diphenylethoxy)ethyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 90807412 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-[1-[1-amino-2-oxo-2-(2-oxo-1,2-diphenylethoxy)ethyl]cyclohexyl]acetic acid |
| SMILES | NC(C(=O)OC(C(=O)c1ccccc1)c1ccccc1)C1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C24H27NO5/c25-22(24(16-19(26)27)14-8-3-9-15-24)23(29)30-21(18-12-6-2-7-13-18)20(28)17-10-4-1-5-11-17/h1-2,4-7,10-13,21-22H,3,8-9,14-16,25H2,(H,26,27) |
| InChIKey | YMTKNFONBVARLB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |