C18H15F3N2O3 — CID 90810707
N-[3-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 90810707) has the molecular formula C18H15F3N2O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is N-[3-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[3-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 90810707 |
| Molecular Formula | C18H15F3N2O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-[3-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(-n2c(O)c3c(c2O)[C@H]2C=C[C@@H]3C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F3N2O3/c1-8(24)22-12-5-11(18(19,20)21)6-13(7-12)23-16(25)14-9-2-3-10(4-9)15(14)17(23)26/h2-3,5-7,9-10,25-26H,4H2,1H3,(H,22,24)/t9-,10+ |
| InChIKey | IDDAHYNOPNPZLF-AOOOYVTPSA-N |
| XLogP | 4.01 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|