C20H15F3N2O3 — CID 90719175
7-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-8-methyl-4-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 90719175) has the molecular formula C20H15F3N2O3 and a molecular weight of 388.35 g/mol. Its IUPAC name is 7-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-8-methyl-4-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 7-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-8-methyl-4-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 90719175 |
| Molecular Formula | C20H15F3N2O3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 7-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-8-methyl-4-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | Cc1c(-n2c(O)c3c(c2O)[C@H]2C=C[C@@H]3C2)ccc2c(C(F)(F)F)cc(=O)[nH]c12 |
| InChI | InChI=1S/C20H15F3N2O3/c1-8-13(5-4-11-12(20(21,22)23)7-14(26)24-17(8)11)25-18(27)15-9-2-3-10(6-9)16(15)19(25)28/h2-5,7,9-10,27-28H,6H2,1H3,(H,24,26)/t9-,10+ |
| InChIKey | QZXUFYBUEYAWJX-AOOOYVTPSA-N |
| XLogP | 4.20 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|