C16H11FN2O2 — CID 90776264
5-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-2-fluorobenzonitrile (PubChem CID 90776264) has the molecular formula C16H11FN2O2 and a molecular weight of 282.27 g/mol. Its IUPAC name is 5-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-2-fluorobenzonitrile.
| Compound Name | 5-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 90776264 |
| Molecular Formula | C16H11FN2O2 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 5-[(1R,7S)-3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(-n2c(O)c3c(c2O)[C@H]2C=C[C@@H]3C2)ccc1F |
| InChI | InChI=1S/C16H11FN2O2/c17-12-4-3-11(6-10(12)7-18)19-15(20)13-8-1-2-9(5-8)14(13)16(19)21/h1-4,6,8-9,20-21H,5H2/t8-,9+ |
| InChIKey | SVXONUWJJPMANB-DTORHVGOSA-N |
| XLogP | 3.04 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|