About 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole
1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole (PubChem CID 90810883) has the molecular formula C14H11N5O4
and a molecular weight of 313.27 g/mol. Its IUPAC name is 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole.
Molecular Properties
| Compound Name | 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole |
| PubChem CID | 90810883 |
| Molecular Formula | C14H11N5O4 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole |
| SMILES | O=[N+]([O-])c1nccn1Cc1cn(-c2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C14H11N5O4/c20-19(21)14-15-3-4-17(14)6-10-7-18(8-16-10)11-1-2-12-13(5-11)23-9-22-12/h1-5,7-8H,6,9H2 |
| InChIKey | MWTOUINCOBRHBW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 97.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole?
The IUPAC name of 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole (CID 90810883) is 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole.
What is the SMILES notation for 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole?
The canonical SMILES for 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole is O=[N+]([O-])c1nccn1Cc1cn(-c2ccc3c(c2)OCO3)cn1.
What is the InChIKey of 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole?
The InChIKey is MWTOUINCOBRHBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N5O4/c20-19(21)14-15-3-4-17(14)6-10-7-18(8-16-10)11-1-2-12-13(5-11)23-9-22-12/h1-5,7-8H,6,9H2.
What are the key properties of 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole?
1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole has a molecular weight of 313.27 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-(1,3-benzodioxol-5-yl)imidazol-4-yl]methyl]-2-nitroimidazole is sourced from PubChem (CID 90810883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).