C23H26N2O6 — CID 90812176
2-[2-methyl-4-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethoxyamino]ethenyl]phenoxy]butanoic acid (PubChem CID 90812176) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-[2-methyl-4-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethoxyamino]ethenyl]phenoxy]butanoic acid.
| Compound Name | 2-[2-methyl-4-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethoxyamino]ethenyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 90812176 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[2-methyl-4-[1-[2-(3-oxo-1,4-benzoxazin-4-yl)ethoxyamino]ethenyl]phenoxy]butanoic acid |
| SMILES | C=C(NOCCN1C(=O)COc2ccccc21)c1ccc(OC(CC)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C23H26N2O6/c1-4-19(23(27)28)31-20-10-9-17(13-15(20)2)16(3)24-30-12-11-25-18-7-5-6-8-21(18)29-14-22(25)26/h5-10,13,19,24H,3-4,11-12,14H2,1-2H3,(H,27,28) |
| InChIKey | KSFITYOZPIXJBW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|