C15H17NO2 — CID 90814743
4-[3-(2-phenylethenyl)-2,5-dihydro-1,2-oxazol-5-yl]butanal (PubChem CID 90814743) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-[3-(2-phenylethenyl)-2,5-dihydro-1,2-oxazol-5-yl]butanal.
| Compound Name | 4-[3-(2-phenylethenyl)-2,5-dihydro-1,2-oxazol-5-yl]butanal |
|---|---|
| PubChem CID | 90814743 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 4-[3-(2-phenylethenyl)-2,5-dihydro-1,2-oxazol-5-yl]butanal |
| SMILES | O=CCCCC1C=C(C=Cc2ccccc2)NO1 |
| InChI | InChI=1S/C15H17NO2/c17-11-5-4-8-15-12-14(16-18-15)10-9-13-6-2-1-3-7-13/h1-3,6-7,9-12,15-16H,4-5,8H2 |
| InChIKey | FEDUICLPLCEWGW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|