C13H14FNO2 — CID 91437897
4-[3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]butanal (PubChem CID 91437897) has the molecular formula C13H14FNO2 and a molecular weight of 235.26 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]butanal.
| Compound Name | 4-[3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]butanal |
|---|---|
| PubChem CID | 91437897 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]butanal |
| SMILES | O=CCCCC1C=C(c2ccc(F)cc2)NO1 |
| InChI | InChI=1S/C13H14FNO2/c14-11-6-4-10(5-7-11)13-9-12(17-15-13)3-1-2-8-16/h4-9,12,15H,1-3H2 |
| InChIKey | BUWGKPXORREHHP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|