C12H13NO2 — CID 91344002
3-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)propanal (PubChem CID 91344002) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)propanal.
| Compound Name | 3-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)propanal |
|---|---|
| PubChem CID | 91344002 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 3-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)propanal |
| SMILES | O=CCCC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C12H13NO2/c14-8-4-7-11-9-12(13-15-11)10-5-2-1-3-6-10/h1-3,5-6,8-9,11,13H,4,7H2 |
| InChIKey | PAWQWGJWHPUWCV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|