C11H11NO3 — CID 91047083
2-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)acetic acid (PubChem CID 91047083) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)acetic acid.
| Compound Name | 2-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)acetic acid |
|---|---|
| PubChem CID | 91047083 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-(3-phenyl-2,5-dihydro-1,2-oxazol-5-yl)acetic acid |
| SMILES | O=C(O)CC1C=C(c2ccccc2)NO1 |
| InChI | InChI=1S/C11H11NO3/c13-11(14)7-9-6-10(12-15-9)8-4-2-1-3-5-8/h1-6,9,12H,7H2,(H,13,14) |
| InChIKey | JDSQRPZZFBYAKR-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |