C12H12FNO2 — CID 90798483
3-[3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]propanal (PubChem CID 90798483) has the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]propanal.
| Compound Name | 3-[3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]propanal |
|---|---|
| PubChem CID | 90798483 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 3-[3-(4-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]propanal |
| SMILES | O=CCCC1C=C(c2ccc(F)cc2)NO1 |
| InChI | InChI=1S/C12H12FNO2/c13-10-5-3-9(4-6-10)12-8-11(16-14-12)2-1-7-15/h3-8,11,14H,1-2H2 |
| InChIKey | NDCBRVBIXJHJBS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|