C11H11NO2 — CID 101057450
(5S)-5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carbaldehyde (PubChem CID 101057450) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is (5S)-5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carbaldehyde.
| Compound Name | (5S)-5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 101057450 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (5S)-5-methyl-3-phenyl-2,5-dihydro-1,2-oxazole-4-carbaldehyde |
| SMILES | C[C@@H]1ONC(c2ccccc2)=C1C=O |
| InChI | InChI=1S/C11H11NO2/c1-8-10(7-13)11(12-14-8)9-5-3-2-4-6-9/h2-8,12H,1H3/t8-/m0/s1 |
| InChIKey | MJGLDCJELFMAFQ-QMMMGPOBSA-N |
| XLogP | 1.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|